C17H25BO5 — CID 99866428
(6S)-2-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4,4,6-trimethyl-1,3,2-dioxaborinane (PubChem CID 99866428) has the molecular formula C17H25BO5 and a molecular weight of 320.19 g/mol. Its IUPAC name is (6S)-2-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4,4,6-trimethyl-1,3,2-dioxaborinane.
| Compound Name | (6S)-2-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4,4,6-trimethyl-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 99866428 |
| Molecular Formula | C17H25BO5 |
| Molecular Weight | 320.19 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | (6S)-2-[3-(1,3-dioxan-2-yl)-4-methoxyphenyl]-4,4,6-trimethyl-1,3,2-dioxaborinane |
| SMILES | COc1ccc(B2O[C@@H](C)CC(C)(C)O2)cc1C1OCCCO1 |
| InChI | InChI=1S/C17H25BO5/c1-12-11-17(2,3)23-18(22-12)13-6-7-15(19-4)14(10-13)16-20-8-5-9-21-16/h6-7,10,12,16H,5,8-9,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | FFADJNBJZLMIQB-LBPRGKRZSA-N |
| XLogP | 2.43 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.19 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|