About (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine
(3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine (PubChem CID 99866729) has the molecular formula C6H13FN2
and a molecular weight of 132.18 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine.
Molecular Properties
| Compound Name | (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine |
| PubChem CID | 99866729 |
| Molecular Formula | C6H13FN2 |
| Molecular Weight | 132.18 g/mol |
| Exact Mass | 132.11 |
| IUPAC Name | (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine |
| SMILES | CN(C)[C@@H]1CNC[C@H]1F |
| InChI | InChI=1S/C6H13FN2/c1-9(2)6-4-8-3-5(6)7/h5-6,8H,3-4H2,1-2H3/t5-,6-/m1/s1 |
| InChIKey | AYFDWGKNWTZXFX-PHDIDXHHSA-N |
| XLogP | -0.14 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine?
The IUPAC name of (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine (CID 99866729) is (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine.
What is the SMILES notation for (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine?
The canonical SMILES for (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine is CN(C)[C@@H]1CNC[C@H]1F.
What is the InChIKey of (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine?
The InChIKey is AYFDWGKNWTZXFX-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H13FN2/c1-9(2)6-4-8-3-5(6)7/h5-6,8H,3-4H2,1-2H3/t5-,6-/m1/s1.
What are the key properties of (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine?
(3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine has a molecular weight of 132.18 g/mol, XLogP of -0.14, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4R)-4-fluoro-N,N-dimethylpyrrolidin-3-amine is sourced from PubChem (CID 99866729), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).