C20H31BN4O5 — CID 99867385
(2S)-1-[(3R)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-2,3-dihydroxypropan-1-one (PubChem CID 99867385) has the molecular formula C20H31BN4O5 and a molecular weight of 418.30 g/mol. Its IUPAC name is (2S)-1-[(3R)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-2,3-dihydroxypropan-1-one.
| Compound Name | (2S)-1-[(3R)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-2,3-dihydroxypropan-1-one |
|---|---|
| PubChem CID | 99867385 |
| Molecular Formula | C20H31BN4O5 |
| Molecular Weight | 418.30 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | (2S)-1-[(3R)-3-[cyclopropyl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]pyrrolidin-1-yl]-2,3-dihydroxypropan-1-one |
| SMILES | CC1(C)OB(c2cnc(N(C3CC3)[C@@H]3CCN(C(=O)[C@@H](O)CO)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C20H31BN4O5/c1-19(2)20(3,4)30-21(29-19)13-9-22-18(23-10-13)25(14-5-6-14)15-7-8-24(11-15)17(28)16(27)12-26/h9-10,14-16,26-27H,5-8,11-12H2,1-4H3/t15-,16+/m1/s1 |
| InChIKey | CJWQYNCJEYHNFH-CVEARBPZSA-N |
| XLogP | -0.30 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|