C18H32BN5O2 — CID 99867447
N'-[[(3S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]methyl]ethane-1,2-diamine (PubChem CID 99867447) has the molecular formula C18H32BN5O2 and a molecular weight of 361.30 g/mol. Its IUPAC name is N'-[[(3S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]methyl]ethane-1,2-diamine.
| Compound Name | N'-[[(3S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 99867447 |
| Molecular Formula | C18H32BN5O2 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.26 |
| IUPAC Name | N'-[[(3S)-1-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]piperidin-3-yl]methyl]ethane-1,2-diamine |
| SMILES | CC1(C)OB(c2cnc(N3CCC[C@@H](CNCCN)C3)nc2)OC1(C)C |
| InChI | InChI=1S/C18H32BN5O2/c1-17(2)18(3,4)26-19(25-17)15-11-22-16(23-12-15)24-9-5-6-14(13-24)10-21-8-7-20/h11-12,14,21H,5-10,13,20H2,1-4H3/t14-/m0/s1 |
| InChIKey | IAKIZPDIAIUOAI-AWEZNQCLSA-N |
| XLogP | 0.54 |
| TPSA | 85.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|