C8H12N2O4 — CID 99868064
3-[(2R)-4-methyl-3,6-dioxopiperazin-2-yl]propanoic acid (PubChem CID 99868064) has the molecular formula C8H12N2O4 and a molecular weight of 200.19 g/mol. Its IUPAC name is 3-[(2R)-4-methyl-3,6-dioxopiperazin-2-yl]propanoic acid.
| Compound Name | 3-[(2R)-4-methyl-3,6-dioxopiperazin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 99868064 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 3-[(2R)-4-methyl-3,6-dioxopiperazin-2-yl]propanoic acid |
| SMILES | CN1CC(=O)N[C@H](CCC(=O)O)C1=O |
| InChI | InChI=1S/C8H12N2O4/c1-10-4-6(11)9-5(8(10)14)2-3-7(12)13/h5H,2-4H2,1H3,(H,9,11)(H,12,13)/t5-/m1/s1 |
| InChIKey | RGVFGSOCLGEYCW-RXMQYKEDSA-N |
| XLogP | -1.19 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |