C10H20N2O — CID 99868070
4-[(3R)-2,2-dimethylpyrrolidin-3-yl]morpholine (PubChem CID 99868070) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is 4-[(3R)-2,2-dimethylpyrrolidin-3-yl]morpholine.
| Compound Name | 4-[(3R)-2,2-dimethylpyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 99868070 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 4-[(3R)-2,2-dimethylpyrrolidin-3-yl]morpholine |
| SMILES | CC1(C)NCC[C@H]1N1CCOCC1 |
| InChI | InChI=1S/C10H20N2O/c1-10(2)9(3-4-11-10)12-5-7-13-8-6-12/h9,11H,3-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | LEESGEVWDFMPMM-SECBINFHSA-N |
| XLogP | 0.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |