C18H17BrF3NO2 — CID 99873935
3-(2-bromophenyl)-N-[(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]propanamide (PubChem CID 99873935) has the molecular formula C18H17BrF3NO2 and a molecular weight of 416.24 g/mol. Its IUPAC name is 3-(2-bromophenyl)-N-[(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]propanamide.
| Compound Name | 3-(2-bromophenyl)-N-[(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 99873935 |
| Molecular Formula | C18H17BrF3NO2 |
| Molecular Weight | 416.24 g/mol |
| Exact Mass | 415.04 |
| IUPAC Name | 3-(2-bromophenyl)-N-[(2S)-2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]propanamide |
| SMILES | O=C(CCc1ccccc1Br)NC[C@@H](O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17BrF3NO2/c19-15-4-2-1-3-12(15)7-10-17(25)23-11-16(24)13-5-8-14(9-6-13)18(20,21)22/h1-6,8-9,16,24H,7,10-11H2,(H,23,25)/t16-/m1/s1 |
| InChIKey | DHKQKTGDRKNJON-MRXNPFEDSA-N |
| XLogP | 4.25 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.24 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |