C17H17NO4 — CID 99874025
(E)-3-(furan-3-yl)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]prop-2-enamide (PubChem CID 99874025) has the molecular formula C17H17NO4 and a molecular weight of 299.33 g/mol. Its IUPAC name is (E)-3-(furan-3-yl)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(furan-3-yl)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99874025 |
| Molecular Formula | C17H17NO4 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | (E)-3-(furan-3-yl)-N-[[(4R)-4-hydroxy-2,3-dihydrochromen-4-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccoc1)NC[C@@]1(O)CCOc2ccccc21 |
| InChI | InChI=1S/C17H17NO4/c19-16(6-5-13-7-9-21-11-13)18-12-17(20)8-10-22-15-4-2-1-3-14(15)17/h1-7,9,11,20H,8,10,12H2,(H,18,19)/b6-5+/t17-/m0/s1 |
| InChIKey | WXXKWUAUCRHTJE-RTRPANQVSA-N |
| XLogP | 2.08 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|