About 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone
1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone (PubChem CID 99878807) has the molecular formula C12H17NO3S
and a molecular weight of 255.34 g/mol. Its IUPAC name is 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone.
Molecular Properties
| Compound Name | 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone |
| PubChem CID | 99878807 |
| Molecular Formula | C12H17NO3S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCS[C@H](c2ccco2)CC1 |
| InChI | InChI=1S/C12H17NO3S/c1-15-9-12(14)13-5-4-11(17-8-6-13)10-3-2-7-16-10/h2-3,7,11H,4-6,8-9H2,1H3/t11-/m0/s1 |
| InChIKey | VTCBHUZMHIDCPT-NSHDSACASA-N |
| XLogP | 1.93 |
| TPSA | 42.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone?
The IUPAC name of 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone (CID 99878807) is 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone.
What is the SMILES notation for 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone?
The canonical SMILES for 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone is COCC(=O)N1CCS[C@H](c2ccco2)CC1.
What is the InChIKey of 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone?
The InChIKey is VTCBHUZMHIDCPT-NSHDSACASA-N. The full InChI is InChI=1S/C12H17NO3S/c1-15-9-12(14)13-5-4-11(17-8-6-13)10-3-2-7-16-10/h2-3,7,11H,4-6,8-9H2,1H3/t11-/m0/s1.
What are the key properties of 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone?
1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone has a molecular weight of 255.34 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(7S)-7-(furan-2-yl)-1,4-thiazepan-4-yl]-2-methoxyethanone is sourced from PubChem (CID 99878807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).