About 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide
5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide (PubChem CID 998792) has the molecular formula C24H26N2O4S
and a molecular weight of 438.55 g/mol. Its IUPAC name is 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide.
Molecular Properties
| Compound Name | 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide |
| PubChem CID | 998792 |
| Molecular Formula | C24H26N2O4S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide |
| SMILES | CCOc1ccc(CC(=O)Nc2sc(Cc3ccccc3)cc2C(N)=O)cc1OCC |
| InChI | InChI=1S/C24H26N2O4S/c1-3-29-20-11-10-17(13-21(20)30-4-2)14-22(27)26-24-19(23(25)28)15-18(31-24)12-16-8-6-5-7-9-16/h5-11,13,15H,3-4,12,14H2,1-2H3,(H2,25,28)(H,26,27) |
| InChIKey | ZIXIHIMMEWWUDN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide?
The IUPAC name of 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide (CID 998792) is 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide.
What is the SMILES notation for 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide?
The canonical SMILES for 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide is CCOc1ccc(CC(=O)Nc2sc(Cc3ccccc3)cc2C(N)=O)cc1OCC.
What is the InChIKey of 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide?
The InChIKey is ZIXIHIMMEWWUDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26N2O4S/c1-3-29-20-11-10-17(13-21(20)30-4-2)14-22(27)26-24-19(23(25)28)15-18(31-24)12-16-8-6-5-7-9-16/h5-11,13,15H,3-4,12,14H2,1-2H3,(H2,25,28)(H,26,27).
What are the key properties of 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide?
5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide has a molecular weight of 438.55 g/mol, XLogP of 4.42, 10 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-benzyl-2-[[2-(3,4-diethoxyphenyl)acetyl]amino]thiophene-3-carboxamide is sourced from PubChem (CID 998792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).