C13H13ClFNO2S — CID 99883987
(1R,5R)-8-(3-chloro-4-fluorophenyl)sulfonyl-8-azabicyclo[3.2.1]oct-2-ene (PubChem CID 99883987) has the molecular formula C13H13ClFNO2S and a molecular weight of 301.77 g/mol. Its IUPAC name is (1R,5R)-8-(3-chloro-4-fluorophenyl)sulfonyl-8-azabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5R)-8-(3-chloro-4-fluorophenyl)sulfonyl-8-azabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 99883987 |
| Molecular Formula | C13H13ClFNO2S |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | (1R,5R)-8-(3-chloro-4-fluorophenyl)sulfonyl-8-azabicyclo[3.2.1]oct-2-ene |
| SMILES | O=S(=O)(c1ccc(F)c(Cl)c1)N1[C@H]2CC=C[C@H]1CC2 |
| InChI | InChI=1S/C13H13ClFNO2S/c14-12-8-11(6-7-13(12)15)19(17,18)16-9-2-1-3-10(16)5-4-9/h1-2,6-10H,3-5H2/t9-,10-/m0/s1 |
| InChIKey | YDXGVCFYXKSVPI-UWVGGRQHSA-N |
| XLogP | 2.96 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|