C20H35BN4O3 — CID 99884868
2-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]ethanol (PubChem CID 99884868) has the molecular formula C20H35BN4O3 and a molecular weight of 390.34 g/mol. Its IUPAC name is 2-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]ethanol.
| Compound Name | 2-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]ethanol |
|---|---|
| PubChem CID | 99884868 |
| Molecular Formula | C20H35BN4O3 |
| Molecular Weight | 390.34 g/mol |
| Exact Mass | 390.28 |
| IUPAC Name | 2-[(2S)-2-[[propan-2-yl-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrimidin-2-yl]amino]methyl]pyrrolidin-1-yl]ethanol |
| SMILES | CC(C)N(C[C@@H]1CCCN1CCO)c1ncc(B2OC(C)(C)C(C)(C)O2)cn1 |
| InChI | InChI=1S/C20H35BN4O3/c1-15(2)25(14-17-8-7-9-24(17)10-11-26)18-22-12-16(13-23-18)21-27-19(3,4)20(5,6)28-21/h12-13,15,17,26H,7-11,14H2,1-6H3/t17-/m0/s1 |
| InChIKey | DXUKGHFQMYMQCR-KRWDZBQOSA-N |
| XLogP | 1.45 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.34 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|