C22H25ClIN3O2 — CID 99886480
N-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-iodo-3-methoxybenzamide (PubChem CID 99886480) has the molecular formula C22H25ClIN3O2 and a molecular weight of 525.82 g/mol. Its IUPAC name is N-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-iodo-3-methoxybenzamide.
| Compound Name | N-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-iodo-3-methoxybenzamide |
|---|---|
| PubChem CID | 99886480 |
| Molecular Formula | C22H25ClIN3O2 |
| Molecular Weight | 525.82 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | N-[(E)-[(4S)-7-chloro-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylideneamino]-4-iodo-3-methoxybenzamide |
| SMILES | COc1cc(C(=O)N/N=C/c2cc3c(cc2Cl)N(C)C(C)(C)C[C@@H]3C)ccc1I |
| InChI | InChI=1S/C22H25ClIN3O2/c1-13-11-22(2,3)27(4)19-10-17(23)15(8-16(13)19)12-25-26-21(28)14-6-7-18(24)20(9-14)29-5/h6-10,12-13H,11H2,1-5H3,(H,26,28)/b25-12+/t13-/m0/s1 |
| InChIKey | QKVGRKAYMGDSKP-XIXVAHAYSA-N |
| XLogP | 5.44 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.82 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|