About 3,7-dimethylocta-2,6-dienoic acid
3,7-dimethylocta-2,6-dienoic acid (PubChem CID 9989) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3,7-dimethylocta-2,6-dienoic acid.
Molecular Properties
| Compound Name | 3,7-dimethylocta-2,6-dienoic acid |
| PubChem CID | 9989 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3,7-dimethylocta-2,6-dienoic acid |
| SMILES | CC(C)=CCCC(C)=CC(=O)O |
| InChI | InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12) |
| InChIKey | ZHYZQXUYZJNEHD-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethylocta-2,6-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethylocta-2,6-dienoic acid?
The IUPAC name of 3,7-dimethylocta-2,6-dienoic acid (CID 9989) is 3,7-dimethylocta-2,6-dienoic acid.
What is the SMILES notation for 3,7-dimethylocta-2,6-dienoic acid?
The canonical SMILES for 3,7-dimethylocta-2,6-dienoic acid is CC(C)=CCCC(C)=CC(=O)O.
What is the InChIKey of 3,7-dimethylocta-2,6-dienoic acid?
The InChIKey is ZHYZQXUYZJNEHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-8(2)5-4-6-9(3)7-10(11)12/h5,7H,4,6H2,1-3H3,(H,11,12).
What are the key properties of 3,7-dimethylocta-2,6-dienoic acid?
3,7-dimethylocta-2,6-dienoic acid has a molecular weight of 168.24 g/mol, XLogP of 2.76, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethylocta-2,6-dienoic acid is sourced from PubChem (CID 9989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).