C16H18N6O2S — CID 998946
3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 998946) has the molecular formula C16H18N6O2S and a molecular weight of 358.43 g/mol. Its IUPAC name is 3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 998946 |
| Molecular Formula | C16H18N6O2S |
| Molecular Weight | 358.43 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 3-[2-(3,5-dimethyl-4-nitropyrazol-1-yl)ethyl]-4-(3-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1cccc(-n2c(CCn3nc(C)c([N+](=O)[O-])c3C)n[nH]c2=S)c1 |
| InChI | InChI=1S/C16H18N6O2S/c1-10-5-4-6-13(9-10)21-14(17-18-16(21)25)7-8-20-12(3)15(22(23)24)11(2)19-20/h4-6,9H,7-8H2,1-3H3,(H,18,25) |
| InChIKey | VRRDUIBPADYHAW-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.43 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|