C16H15N3OS — CID 99897451
4-[(5S,6S)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol (PubChem CID 99897451) has the molecular formula C16H15N3OS and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-[(5S,6S)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol.
| Compound Name | 4-[(5S,6S)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
|---|---|
| PubChem CID | 99897451 |
| Molecular Formula | C16H15N3OS |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 4-[(5S,6S)-6-pyridin-2-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazol-5-yl]phenol |
| SMILES | Oc1ccc([C@H]2[C@@H](c3ccccn3)N=C3SCCN32)cc1 |
| InChI | InChI=1S/C16H15N3OS/c20-12-6-4-11(5-7-12)15-14(13-3-1-2-8-17-13)18-16-19(15)9-10-21-16/h1-8,14-15,20H,9-10H2/t14-,15+/m1/s1 |
| InChIKey | PPVSNSJETPLQFG-CABCVRRESA-N |
| XLogP | 2.99 |
| TPSA | 48.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |