C19H20FNO5S2 — CID 99903358
1-[4-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]sulfonylphenyl]ethanone (PubChem CID 99903358) has the molecular formula C19H20FNO5S2 and a molecular weight of 425.50 g/mol. Its IUPAC name is 1-[4-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]sulfonylphenyl]ethanone.
| Compound Name | 1-[4-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]sulfonylphenyl]ethanone |
|---|---|
| PubChem CID | 99903358 |
| Molecular Formula | C19H20FNO5S2 |
| Molecular Weight | 425.50 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 1-[4-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]sulfonylphenyl]ethanone |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCC[C@H](S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C19H20FNO5S2/c1-14(22)15-4-8-18(9-5-15)28(25,26)21-12-2-3-19(13-21)27(23,24)17-10-6-16(20)7-11-17/h4-11,19H,2-3,12-13H2,1H3/t19-/m0/s1 |
| InChIKey | HCEDUKYXKHKBPE-IBGZPJMESA-N |
| XLogP | 2.66 |
| TPSA | 88.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.50 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |