About (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one
(3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 99903413) has the molecular formula C18H17NO4S
and a molecular weight of 343.40 g/mol. Its IUPAC name is (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
Molecular Properties
| Compound Name | (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| PubChem CID | 99903413 |
| Molecular Formula | C18H17NO4S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | O=C1O[C@]2(CCCN(S(=O)(=O)c3ccccc3)C2)c2ccccc21 |
| InChI | InChI=1S/C18H17NO4S/c20-17-15-9-4-5-10-16(15)18(23-17)11-6-12-19(13-18)24(21,22)14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2/t18-/m0/s1 |
| InChIKey | GOQJWXLHBPZRKV-SFHVURJKSA-N |
| XLogP | 2.54 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one?
The IUPAC name of (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one (CID 99903413) is (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one.
What is the SMILES notation for (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one?
The canonical SMILES for (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one is O=C1O[C@]2(CCCN(S(=O)(=O)c3ccccc3)C2)c2ccccc21.
What is the InChIKey of (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one?
The InChIKey is GOQJWXLHBPZRKV-SFHVURJKSA-N. The full InChI is InChI=1S/C18H17NO4S/c20-17-15-9-4-5-10-16(15)18(23-17)11-6-12-19(13-18)24(21,22)14-7-2-1-3-8-14/h1-5,7-10H,6,11-13H2/t18-/m0/s1.
What are the key properties of (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one?
(3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one has a molecular weight of 343.40 g/mol, XLogP of 2.54, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1'-(benzenesulfonyl)spiro[2-benzofuran-3,3'-piperidine]-1-one is sourced from PubChem (CID 99903413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).