About 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone
1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone (PubChem CID 99903708) has the molecular formula C15H16ClNO
and a molecular weight of 261.75 g/mol. Its IUPAC name is 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone.
Molecular Properties
| Compound Name | 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone |
| PubChem CID | 99903708 |
| Molecular Formula | C15H16ClNO |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone |
| SMILES | O=C(Cc1ccccc1Cl)N1[C@H]2CC=C[C@H]1CC2 |
| InChI | InChI=1S/C15H16ClNO/c16-14-7-2-1-4-11(14)10-15(18)17-12-5-3-6-13(17)9-8-12/h1-5,7,12-13H,6,8-10H2/t12-,13-/m0/s1 |
| InChIKey | RRMWLUNSAQMWJF-STQMWFEESA-N |
| XLogP | 3.20 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone?
The IUPAC name of 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone (CID 99903708) is 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone.
What is the SMILES notation for 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone?
The canonical SMILES for 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone is O=C(Cc1ccccc1Cl)N1[C@H]2CC=C[C@H]1CC2.
What is the InChIKey of 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone?
The InChIKey is RRMWLUNSAQMWJF-STQMWFEESA-N. The full InChI is InChI=1S/C15H16ClNO/c16-14-7-2-1-4-11(14)10-15(18)17-12-5-3-6-13(17)9-8-12/h1-5,7,12-13H,6,8-10H2/t12-,13-/m0/s1.
What are the key properties of 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone?
1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone has a molecular weight of 261.75 g/mol, XLogP of 3.20, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-2-(2-chlorophenyl)ethanone is sourced from PubChem (CID 99903708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).