C15H13F4N5S — CID 999054
3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione (PubChem CID 999054) has the molecular formula C15H13F4N5S and a molecular weight of 371.36 g/mol. Its IUPAC name is 3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 999054 |
| Molecular Formula | C15H13F4N5S |
| Molecular Weight | 371.36 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 3-[[3,5-bis(difluoromethyl)pyrazol-1-yl]methyl]-4-(4-methylphenyl)-1H-1,2,4-triazole-5-thione |
| SMILES | Cc1ccc(-n2c(Cn3nc(C(F)F)cc3C(F)F)n[nH]c2=S)cc1 |
| InChI | InChI=1S/C15H13F4N5S/c1-8-2-4-9(5-3-8)24-12(20-21-15(24)25)7-23-11(14(18)19)6-10(22-23)13(16)17/h2-6,13-14H,7H2,1H3,(H,21,25) |
| InChIKey | RWOJVZNUCLVYOH-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 51.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.36 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|