C20H31N5O3Si — CID 99910729
benzyl (2R,4S)-4-(2H-tetrazol-5-yl)-2-(2-trimethylsilylethoxymethyl)piperidine-1-carboxylate (PubChem CID 99910729) has the molecular formula C20H31N5O3Si and a molecular weight of 417.59 g/mol. Its IUPAC name is benzyl (2R,4S)-4-(2H-tetrazol-5-yl)-2-(2-trimethylsilylethoxymethyl)piperidine-1-carboxylate.
| Compound Name | benzyl (2R,4S)-4-(2H-tetrazol-5-yl)-2-(2-trimethylsilylethoxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 99910729 |
| Molecular Formula | C20H31N5O3Si |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | benzyl (2R,4S)-4-(2H-tetrazol-5-yl)-2-(2-trimethylsilylethoxymethyl)piperidine-1-carboxylate |
| SMILES | C[Si](C)(C)CCOC[C@H]1C[C@@H](c2nn[nH]n2)CCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H31N5O3Si/c1-29(2,3)12-11-27-15-18-13-17(19-21-23-24-22-19)9-10-25(18)20(26)28-14-16-7-5-4-6-8-16/h4-8,17-18H,9-15H2,1-3H3,(H,21,22,23,24)/t17-,18+/m0/s1 |
| InChIKey | WUQNNFRPLQBSIZ-ZWKOTPCHSA-N |
| XLogP | 3.44 |
| TPSA | 93.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|