About (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one
(2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one (PubChem CID 99913618) has the molecular formula C18H16O3
and a molecular weight of 280.32 g/mol. Its IUPAC name is (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one |
| PubChem CID | 99913618 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one |
| SMILES | COc1cc(/C=C2/Cc3ccccc3C2=O)cc(OC)c1 |
| InChI | InChI=1S/C18H16O3/c1-20-15-8-12(9-16(11-15)21-2)7-14-10-13-5-3-4-6-17(13)18(14)19/h3-9,11H,10H2,1-2H3/b14-7- |
| InChIKey | NDPCIXWKTXJJFJ-AUWJEWJLSA-N |
| XLogP | 3.53 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one?
The IUPAC name of (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one (CID 99913618) is (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one.
What is the SMILES notation for (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one?
The canonical SMILES for (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one is COc1cc(/C=C2/Cc3ccccc3C2=O)cc(OC)c1.
What is the InChIKey of (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one?
The InChIKey is NDPCIXWKTXJJFJ-AUWJEWJLSA-N. The full InChI is InChI=1S/C18H16O3/c1-20-15-8-12(9-16(11-15)21-2)7-14-10-13-5-3-4-6-17(13)18(14)19/h3-9,11H,10H2,1-2H3/b14-7-.
What are the key properties of (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one?
(2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one has a molecular weight of 280.32 g/mol, XLogP of 3.53, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-[(3,5-dimethoxyphenyl)methylidene]-3H-inden-1-one is sourced from PubChem (CID 99913618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).