C16H21N3O2 — CID 99927726
N-ethyl-N-[[(2S)-oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide (PubChem CID 99927726) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-ethyl-N-[[(2S)-oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-ethyl-N-[[(2S)-oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 99927726 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-ethyl-N-[[(2S)-oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide |
| SMILES | CCN(C[C@@H]1CCCCO1)C(=O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C16H21N3O2/c1-2-19(11-12-7-5-6-10-21-12)16(20)15-17-13-8-3-4-9-14(13)18-15/h3-4,8-9,12H,2,5-7,10-11H2,1H3,(H,17,18)/t12-/m0/s1 |
| InChIKey | UVZNNZVZURYGET-LBPRGKRZSA-N |
| XLogP | 2.59 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |