About (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine
(1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine (PubChem CID 99927767) has the molecular formula C18H23N3O
and a molecular weight of 297.40 g/mol. Its IUPAC name is (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine.
Molecular Properties
| Compound Name | (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine |
| PubChem CID | 99927767 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine |
| SMILES | C[C@@H](c1ccncn1)N(C)Cc1ccc2c(c1)CC(C)(C)O2 |
| InChI | InChI=1S/C18H23N3O/c1-13(16-7-8-19-12-20-16)21(4)11-14-5-6-17-15(9-14)10-18(2,3)22-17/h5-9,12-13H,10-11H2,1-4H3/t13-/m0/s1 |
| InChIKey | FSGBPEMJHZKMGB-ZDUSSCGKSA-N |
| XLogP | 3.38 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine?
The IUPAC name of (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine (CID 99927767) is (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine.
What is the SMILES notation for (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine?
The canonical SMILES for (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine is C[C@@H](c1ccncn1)N(C)Cc1ccc2c(c1)CC(C)(C)O2.
What is the InChIKey of (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine?
The InChIKey is FSGBPEMJHZKMGB-ZDUSSCGKSA-N. The full InChI is InChI=1S/C18H23N3O/c1-13(16-7-8-19-12-20-16)21(4)11-14-5-6-17-15(9-14)10-18(2,3)22-17/h5-9,12-13H,10-11H2,1-4H3/t13-/m0/s1.
What are the key properties of (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine?
(1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine has a molecular weight of 297.40 g/mol, XLogP of 3.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(2,2-dimethyl-3H-1-benzofuran-5-yl)methyl]-N-methyl-1-pyrimidin-4-ylethanamine is sourced from PubChem (CID 99927767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).