About (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine
(4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine (PubChem CID 99927891) has the molecular formula C14H26N4
and a molecular weight of 250.39 g/mol. Its IUPAC name is (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine.
Molecular Properties
| Compound Name | (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine |
| PubChem CID | 99927891 |
| Molecular Formula | C14H26N4 |
| Molecular Weight | 250.39 g/mol |
| Exact Mass | 250.22 |
| IUPAC Name | (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine |
| SMILES | Cc1n[nH]c(C)c1CN1CCC[C@H](N(C)C)CC1 |
| InChI | InChI=1S/C14H26N4/c1-11-14(12(2)16-15-11)10-18-8-5-6-13(7-9-18)17(3)4/h13H,5-10H2,1-4H3,(H,15,16)/t13-/m0/s1 |
| InChIKey | CPVYGNODEQXLCN-ZDUSSCGKSA-N |
| XLogP | 1.94 |
| TPSA | 35.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine?
The IUPAC name of (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine (CID 99927891) is (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine.
What is the SMILES notation for (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine?
The canonical SMILES for (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine is Cc1n[nH]c(C)c1CN1CCC[C@H](N(C)C)CC1.
What is the InChIKey of (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine?
The InChIKey is CPVYGNODEQXLCN-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H26N4/c1-11-14(12(2)16-15-11)10-18-8-5-6-13(7-9-18)17(3)4/h13H,5-10H2,1-4H3,(H,15,16)/t13-/m0/s1.
What are the key properties of (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine?
(4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine has a molecular weight of 250.39 g/mol, XLogP of 1.94, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]-N,N-dimethylazepan-4-amine is sourced from PubChem (CID 99927891), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).