C22H27N3O — CID 99929466
N-[(1-ethylindol-4-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-(pyridin-2-ylmethyl)methanamine (PubChem CID 99929466) has the molecular formula C22H27N3O and a molecular weight of 349.48 g/mol. Its IUPAC name is N-[(1-ethylindol-4-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-(pyridin-2-ylmethyl)methanamine.
| Compound Name | N-[(1-ethylindol-4-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-(pyridin-2-ylmethyl)methanamine |
|---|---|
| PubChem CID | 99929466 |
| Molecular Formula | C22H27N3O |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.22 |
| IUPAC Name | N-[(1-ethylindol-4-yl)methyl]-1-[(2R)-oxolan-2-yl]-N-(pyridin-2-ylmethyl)methanamine |
| SMILES | CCn1ccc2c(CN(Cc3ccccn3)C[C@H]3CCCO3)cccc21 |
| InChI | InChI=1S/C22H27N3O/c1-2-25-13-11-21-18(7-5-10-22(21)25)15-24(17-20-9-6-14-26-20)16-19-8-3-4-12-23-19/h3-5,7-8,10-13,20H,2,6,9,14-17H2,1H3/t20-/m1/s1 |
| InChIKey | FATJBTJXIBCIOC-HXUWFJFHSA-N |
| XLogP | 4.24 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |