C19H26N4O — CID 99931868
N-[(5R,7R)-3-ethyl-1-adamantyl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide (PubChem CID 99931868) has the molecular formula C19H26N4O and a molecular weight of 326.44 g/mol. Its IUPAC name is N-[(5R,7R)-3-ethyl-1-adamantyl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide.
| Compound Name | N-[(5R,7R)-3-ethyl-1-adamantyl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
|---|---|
| PubChem CID | 99931868 |
| Molecular Formula | C19H26N4O |
| Molecular Weight | 326.44 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | N-[(5R,7R)-3-ethyl-1-adamantyl]-1-methylimidazo[2,1-e]pyrazole-7-carboxamide |
| SMILES | CCC12C[C@H]3C[C@H](C1)CC(NC(=O)c1cnn4ccn(C)c14)(C3)C2 |
| InChI | InChI=1S/C19H26N4O/c1-3-18-7-13-6-14(8-18)10-19(9-13,12-18)21-16(24)15-11-20-23-5-4-22(2)17(15)23/h4-5,11,13-14H,3,6-10,12H2,1-2H3,(H,21,24)/t13-,14-,18?,19?/m1/s1 |
| InChIKey | MGIPLVOHOFLNRG-CXTCDGGRSA-N |
| XLogP | 3.15 |
| TPSA | 51.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |