C20H26N6O — CID 99931870
3-[(2S)-1-[[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]pyrrolidin-2-yl]-5-methyl-1H-1,2,4-triazole (PubChem CID 99931870) has the molecular formula C20H26N6O and a molecular weight of 366.47 g/mol. Its IUPAC name is 3-[(2S)-1-[[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]pyrrolidin-2-yl]-5-methyl-1H-1,2,4-triazole.
| Compound Name | 3-[(2S)-1-[[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]pyrrolidin-2-yl]-5-methyl-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 99931870 |
| Molecular Formula | C20H26N6O |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3-[(2S)-1-[[4-(3-imidazol-1-ylpropoxy)phenyl]methyl]pyrrolidin-2-yl]-5-methyl-1H-1,2,4-triazole |
| SMILES | Cc1nc([C@@H]2CCCN2Cc2ccc(OCCCn3ccnc3)cc2)n[nH]1 |
| InChI | InChI=1S/C20H26N6O/c1-16-22-20(24-23-16)19-4-2-11-26(19)14-17-5-7-18(8-6-17)27-13-3-10-25-12-9-21-15-25/h5-9,12,15,19H,2-4,10-11,13-14H2,1H3,(H,22,23,24)/t19-/m0/s1 |
| InChIKey | OZVVLUVHZMWAOH-IBGZPJMESA-N |
| XLogP | 3.12 |
| TPSA | 71.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|