About 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol
2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol (PubChem CID 99932266) has the molecular formula C17H23N3O2S
and a molecular weight of 333.46 g/mol. Its IUPAC name is 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol |
| PubChem CID | 99932266 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol |
| SMILES | OCCn1ncc2c1CN(Cc1ccc([C@H]3CCCCO3)s1)C2 |
| InChI | InChI=1S/C17H23N3O2S/c21-7-6-20-15-12-19(10-13(15)9-18-20)11-14-4-5-17(23-14)16-3-1-2-8-22-16/h4-5,9,16,21H,1-3,6-8,10-12H2/t16-/m1/s1 |
| InChIKey | DBXBCLXAQCMROX-MRXNPFEDSA-N |
| XLogP | 2.69 |
| TPSA | 50.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The IUPAC name of 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol (CID 99932266) is 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol.
What is the SMILES notation for 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The canonical SMILES for 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol is OCCn1ncc2c1CN(Cc1ccc([C@H]3CCCCO3)s1)C2.
What is the InChIKey of 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
The InChIKey is DBXBCLXAQCMROX-MRXNPFEDSA-N. The full InChI is InChI=1S/C17H23N3O2S/c21-7-6-20-15-12-19(10-13(15)9-18-20)11-14-4-5-17(23-14)16-3-1-2-8-22-16/h4-5,9,16,21H,1-3,6-8,10-12H2/t16-/m1/s1.
What are the key properties of 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol?
2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol has a molecular weight of 333.46 g/mol, XLogP of 2.69, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[[5-[(2R)-oxan-2-yl]thiophen-2-yl]methyl]-4,6-dihydropyrrolo[3,4-d]pyrazol-1-yl]ethanol is sourced from PubChem (CID 99932266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).