C12H22N2S2 — CID 99932436
N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N-methyl-3-methylsulfanylpropan-1-amine (PubChem CID 99932436) has the molecular formula C12H22N2S2 and a molecular weight of 258.46 g/mol. Its IUPAC name is N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N-methyl-3-methylsulfanylpropan-1-amine.
| Compound Name | N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N-methyl-3-methylsulfanylpropan-1-amine |
|---|---|
| PubChem CID | 99932436 |
| Molecular Formula | C12H22N2S2 |
| Molecular Weight | 258.46 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[(1R)-1-(2,5-dimethyl-1,3-thiazol-4-yl)ethyl]-N-methyl-3-methylsulfanylpropan-1-amine |
| SMILES | CSCCCN(C)[C@H](C)c1nc(C)sc1C |
| InChI | InChI=1S/C12H22N2S2/c1-9(14(4)7-6-8-15-5)12-10(2)16-11(3)13-12/h9H,6-8H2,1-5H3/t9-/m1/s1 |
| InChIKey | WJQLSVRBOKTMDD-SECBINFHSA-N |
| XLogP | 3.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.46 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|