C16H27N3O3 — CID 99932500
(5S)-9-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-1-oxa-9-azaspiro[5.5]undecan-5-ol (PubChem CID 99932500) has the molecular formula C16H27N3O3 and a molecular weight of 309.41 g/mol. Its IUPAC name is (5S)-9-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-1-oxa-9-azaspiro[5.5]undecan-5-ol.
| Compound Name | (5S)-9-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-1-oxa-9-azaspiro[5.5]undecan-5-ol |
|---|---|
| PubChem CID | 99932500 |
| Molecular Formula | C16H27N3O3 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (5S)-9-[[1-(2-methoxyethyl)imidazol-2-yl]methyl]-1-oxa-9-azaspiro[5.5]undecan-5-ol |
| SMILES | COCCn1ccnc1CN1CCC2(CC1)OCCC[C@@H]2O |
| InChI | InChI=1S/C16H27N3O3/c1-21-12-10-19-9-6-17-15(19)13-18-7-4-16(5-8-18)14(20)3-2-11-22-16/h6,9,14,20H,2-5,7-8,10-13H2,1H3/t14-/m0/s1 |
| InChIKey | JBBSHRDOGKLREJ-AWEZNQCLSA-N |
| XLogP | 1.04 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |