About (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid
(3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid (PubChem CID 99933375) has the molecular formula C14H13N3O5
and a molecular weight of 303.27 g/mol. Its IUPAC name is (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid.
Molecular Properties
| Compound Name | (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid |
| PubChem CID | 99933375 |
| Molecular Formula | C14H13N3O5 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.09 |
| IUPAC Name | (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C[C@@H](NC(=O)c1c[nH]c(=O)[nH]c1=O)c1ccccc1 |
| InChI | InChI=1S/C14H13N3O5/c18-11(19)6-10(8-4-2-1-3-5-8)16-12(20)9-7-15-14(22)17-13(9)21/h1-5,7,10H,6H2,(H,16,20)(H,18,19)(H2,15,17,21,22)/t10-/m1/s1 |
| InChIKey | QYEKMOVVKHPUTO-SNVBAGLBSA-N |
| XLogP | 0.01 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid?
The IUPAC name of (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid (CID 99933375) is (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid.
What is the SMILES notation for (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid?
The canonical SMILES for (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid is O=C(O)C[C@@H](NC(=O)c1c[nH]c(=O)[nH]c1=O)c1ccccc1.
What is the InChIKey of (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid?
The InChIKey is QYEKMOVVKHPUTO-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H13N3O5/c18-11(19)6-10(8-4-2-1-3-5-8)16-12(20)9-7-15-14(22)17-13(9)21/h1-5,7,10H,6H2,(H,16,20)(H,18,19)(H2,15,17,21,22)/t10-/m1/s1.
What are the key properties of (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid?
(3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid has a molecular weight of 303.27 g/mol, XLogP of 0.01, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-[(2,4-dioxo-1H-pyrimidine-5-carbonyl)amino]-3-phenylpropanoic acid is sourced from PubChem (CID 99933375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).