C19H23N3OS2 — CID 99934386
[2-oxo-2-(quinolin-5-ylamino)ethyl] (2S,6S)-2,6-dimethylpiperidine-1-carbodithioate (PubChem CID 99934386) has the molecular formula C19H23N3OS2 and a molecular weight of 373.55 g/mol. Its IUPAC name is [2-oxo-2-(quinolin-5-ylamino)ethyl] (2S,6S)-2,6-dimethylpiperidine-1-carbodithioate.
| Compound Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] (2S,6S)-2,6-dimethylpiperidine-1-carbodithioate |
|---|---|
| PubChem CID | 99934386 |
| Molecular Formula | C19H23N3OS2 |
| Molecular Weight | 373.55 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] (2S,6S)-2,6-dimethylpiperidine-1-carbodithioate |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=S)SCC(=O)Nc1cccc2ncccc12 |
| InChI | InChI=1S/C19H23N3OS2/c1-13-6-3-7-14(2)22(13)19(24)25-12-18(23)21-17-10-4-9-16-15(17)8-5-11-20-16/h4-5,8-11,13-14H,3,6-7,12H2,1-2H3,(H,21,23)/t13-,14-/m0/s1 |
| InChIKey | PEIKONYALJJOOB-KBPBESRZSA-N |
| XLogP | 4.45 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.55 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|