C28H27N3O2S2 — CID 99936185
[(1R)-2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate (PubChem CID 99936185) has the molecular formula C28H27N3O2S2 and a molecular weight of 501.68 g/mol. Its IUPAC name is [(1R)-2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate.
| Compound Name | [(1R)-2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
|---|---|
| PubChem CID | 99936185 |
| Molecular Formula | C28H27N3O2S2 |
| Molecular Weight | 501.68 g/mol |
| Exact Mass | 501.15 |
| IUPAC Name | [(1R)-2-(2,3-dihydroindol-1-yl)-2-oxo-1-phenylethyl] (1S,9R)-6-oxo-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carbodithioate |
| SMILES | O=C([C@H](SC(=S)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2)c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C28H27N3O2S2/c32-25-12-6-11-24-22-15-19(17-31(24)25)16-29(18-22)28(34)35-26(21-8-2-1-3-9-21)27(33)30-14-13-20-7-4-5-10-23(20)30/h1-12,19,22,26H,13-18H2/t19-,22-,26+/m0/s1 |
| InChIKey | UEDZRHBUSKPHCQ-NDIWIEOSSA-N |
| XLogP | 4.62 |
| TPSA | 45.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.68 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|