C33H43N5O8 — CID 99936347
(2S)-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid (PubChem CID 99936347) has the molecular formula C33H43N5O8 and a molecular weight of 637.73 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 99936347 |
| Molecular Formula | C33H43N5O8 |
| Molecular Weight | 637.73 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)CNC(=O)[C@@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)C)C(=O)O |
| InChI | InChI=1S/C33H43N5O8/c1-18(2)15-26(32(43)44)37-30(41)25(13-14-27(34)39)36-28(40)16-35-31(42)29(19(3)4)38-33(45)46-17-24-22-11-7-5-9-20(22)21-10-6-8-12-23(21)24/h5-12,18-19,24-26,29H,13-17H2,1-4H3,(H2,34,39)(H,35,42)(H,36,40)(H,37,41)(H,38,45)(H,43,44)/t25-,26-,29-/m0/s1 |
| InChIKey | UJGONYDKKYTFPA-ZEZDXWPOSA-N |
| XLogP | 2.03 |
| TPSA | 206.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.73 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |