C18H19N5O3S2 — CID 99936630
(2R)-N-[4-(ethylsulfamoyl)phenyl]-2-phenyl-2-(2H-triazol-4-ylsulfanyl)acetamide (PubChem CID 99936630) has the molecular formula C18H19N5O3S2 and a molecular weight of 417.52 g/mol. Its IUPAC name is (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-phenyl-2-(2H-triazol-4-ylsulfanyl)acetamide.
| Compound Name | (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-phenyl-2-(2H-triazol-4-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 99936630 |
| Molecular Formula | C18H19N5O3S2 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.09 |
| IUPAC Name | (2R)-N-[4-(ethylsulfamoyl)phenyl]-2-phenyl-2-(2H-triazol-4-ylsulfanyl)acetamide |
| SMILES | CCNS(=O)(=O)c1ccc(NC(=O)[C@H](Sc2cn[nH]n2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H19N5O3S2/c1-2-20-28(25,26)15-10-8-14(9-11-15)21-18(24)17(13-6-4-3-5-7-13)27-16-12-19-23-22-16/h3-12,17,20H,2H2,1H3,(H,21,24)(H,19,22,23)/t17-/m1/s1 |
| InChIKey | OHQANUJVXNZCKQ-QGZVFWFLSA-N |
| XLogP | 2.58 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |