C15H18N4O5S — CID 99936714
N-[2-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]ethyl]-4-sulfamoylbenzamide (PubChem CID 99936714) has the molecular formula C15H18N4O5S and a molecular weight of 366.40 g/mol. Its IUPAC name is N-[2-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]ethyl]-4-sulfamoylbenzamide.
| Compound Name | N-[2-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]ethyl]-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 99936714 |
| Molecular Formula | C15H18N4O5S |
| Molecular Weight | 366.40 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | N-[2-[5-[(2R)-oxolan-2-yl]-1,2,4-oxadiazol-3-yl]ethyl]-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCCc2noc([C@H]3CCCO3)n2)cc1 |
| InChI | InChI=1S/C15H18N4O5S/c16-25(21,22)11-5-3-10(4-6-11)14(20)17-8-7-13-18-15(24-19-13)12-2-1-9-23-12/h3-6,12H,1-2,7-9H2,(H,17,20)(H2,16,21,22)/t12-/m1/s1 |
| InChIKey | BVDCFQYMYQPKKB-GFCCVEGCSA-N |
| XLogP | 0.54 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.40 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |