C18H23NO3S — CID 99936738
2-[(2R)-4-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methyl]morpholin-2-yl]ethanol (PubChem CID 99936738) has the molecular formula C18H23NO3S and a molecular weight of 333.45 g/mol. Its IUPAC name is 2-[(2R)-4-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methyl]morpholin-2-yl]ethanol.
| Compound Name | 2-[(2R)-4-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methyl]morpholin-2-yl]ethanol |
|---|---|
| PubChem CID | 99936738 |
| Molecular Formula | C18H23NO3S |
| Molecular Weight | 333.45 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | 2-[(2R)-4-[[5-(4-methylphenyl)sulfanylfuran-2-yl]methyl]morpholin-2-yl]ethanol |
| SMILES | Cc1ccc(Sc2ccc(CN3CCO[C@H](CCO)C3)o2)cc1 |
| InChI | InChI=1S/C18H23NO3S/c1-14-2-5-17(6-3-14)23-18-7-4-16(22-18)13-19-9-11-21-15(12-19)8-10-20/h2-7,15,20H,8-13H2,1H3/t15-/m1/s1 |
| InChIKey | QFTXXZOJOSXMMU-OAHLLOKOSA-N |
| XLogP | 3.32 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.45 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |