C25H22N2O2 — CID 99937613
(E)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2,3-diphenylprop-2-enamide (PubChem CID 99937613) has the molecular formula C25H22N2O2 and a molecular weight of 382.46 g/mol. Its IUPAC name is (E)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2,3-diphenylprop-2-enamide.
| Compound Name | (E)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2,3-diphenylprop-2-enamide |
|---|---|
| PubChem CID | 99937613 |
| Molecular Formula | C25H22N2O2 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | (E)-N-[4-(2-oxopyrrolidin-1-yl)phenyl]-2,3-diphenylprop-2-enamide |
| SMILES | O=C(Nc1ccc(N2CCCC2=O)cc1)/C(=C/c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22N2O2/c28-24-12-7-17-27(24)22-15-13-21(14-16-22)26-25(29)23(20-10-5-2-6-11-20)18-19-8-3-1-4-9-19/h1-6,8-11,13-16,18H,7,12,17H2,(H,26,29)/b23-18+ |
| InChIKey | NTOKETZENDYOOO-PTGBLXJZSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|