C24H21BrN4O3S — CID 99940421
2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(4-imidazol-1-ylphenyl)methyl]acetamide (PubChem CID 99940421) has the molecular formula C24H21BrN4O3S and a molecular weight of 525.43 g/mol. Its IUPAC name is 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(4-imidazol-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(4-imidazol-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 99940421 |
| Molecular Formula | C24H21BrN4O3S |
| Molecular Weight | 525.43 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | 2-[N-(benzenesulfonyl)-3-bromoanilino]-N-[(4-imidazol-1-ylphenyl)methyl]acetamide |
| SMILES | O=C(CN(c1cccc(Br)c1)S(=O)(=O)c1ccccc1)NCc1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C24H21BrN4O3S/c25-20-5-4-6-22(15-20)29(33(31,32)23-7-2-1-3-8-23)17-24(30)27-16-19-9-11-21(12-10-19)28-14-13-26-18-28/h1-15,18H,16-17H2,(H,27,30) |
| InChIKey | DIBPQZZUXZQKKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |