C25H26BrN3O5S2 — CID 99941437
1-[(3-bromophenyl)methylsulfonyl]-N-[4-(phenylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 99941437) has the molecular formula C25H26BrN3O5S2 and a molecular weight of 592.54 g/mol. Its IUPAC name is 1-[(3-bromophenyl)methylsulfonyl]-N-[4-(phenylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-[(3-bromophenyl)methylsulfonyl]-N-[4-(phenylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 99941437 |
| Molecular Formula | C25H26BrN3O5S2 |
| Molecular Weight | 592.54 g/mol |
| Exact Mass | 591.05 |
| IUPAC Name | 1-[(3-bromophenyl)methylsulfonyl]-N-[4-(phenylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)C1CCN(S(=O)(=O)Cc2cccc(Br)c2)CC1 |
| InChI | InChI=1S/C25H26BrN3O5S2/c26-21-6-4-5-19(17-21)18-35(31,32)29-15-13-20(14-16-29)25(30)27-22-9-11-24(12-10-22)36(33,34)28-23-7-2-1-3-8-23/h1-12,17,20,28H,13-16,18H2,(H,27,30) |
| InChIKey | DARVVAPGWKYTEW-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |