C13H19N5O5 — CID 99941492
2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]acetamide (PubChem CID 99941492) has the molecular formula C13H19N5O5 and a molecular weight of 325.33 g/mol. Its IUPAC name is 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]acetamide.
| Compound Name | 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]acetamide |
|---|---|
| PubChem CID | 99941492 |
| Molecular Formula | C13H19N5O5 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-[(4R)-2,5-dioxo-1-propylimidazolidin-4-yl]-N-[2-[(4-methyl-1,2,5-oxadiazol-3-yl)oxy]ethyl]acetamide |
| SMILES | CCCN1C(=O)N[C@H](CC(=O)NCCOc2nonc2C)C1=O |
| InChI | InChI=1S/C13H19N5O5/c1-3-5-18-12(20)9(15-13(18)21)7-10(19)14-4-6-22-11-8(2)16-23-17-11/h9H,3-7H2,1-2H3,(H,14,19)(H,15,21)/t9-/m1/s1 |
| InChIKey | IGVKYQNCHMNLTR-SECBINFHSA-N |
| XLogP | -0.41 |
| TPSA | 126.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|