C9H6Cl6O — CID 99941504
1-[(1R,2S,4R)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]ethanone (PubChem CID 99941504) has the molecular formula C9H6Cl6O and a molecular weight of 342.86 g/mol. Its IUPAC name is 1-[(1R,2S,4R)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]ethanone.
| Compound Name | 1-[(1R,2S,4R)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
|---|---|
| PubChem CID | 99941504 |
| Molecular Formula | C9H6Cl6O |
| Molecular Weight | 342.86 g/mol |
| Exact Mass | 339.85 |
| IUPAC Name | 1-[(1R,2S,4R)-1,4,5,6,7,7-hexachloro-2-bicyclo[2.2.1]hept-5-enyl]ethanone |
| SMILES | CC(=O)[C@@H]1C[C@@]2(Cl)C(Cl)=C(Cl)[C@@]1(Cl)C2(Cl)Cl |
| InChI | InChI=1S/C9H6Cl6O/c1-3(16)4-2-7(12)5(10)6(11)8(4,13)9(7,14)15/h4H,2H2,1H3/t4-,7+,8+/m0/s1 |
| InChIKey | TWQVXDHJCLPJQC-MNWLTOSCSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.86 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|