C13H24O2 — CID 99942030
(2S,3aR,4S,7aR)-2-ethoxy-4,6,6-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran (PubChem CID 99942030) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (2S,3aR,4S,7aR)-2-ethoxy-4,6,6-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran.
| Compound Name | (2S,3aR,4S,7aR)-2-ethoxy-4,6,6-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
|---|---|
| PubChem CID | 99942030 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (2S,3aR,4S,7aR)-2-ethoxy-4,6,6-trimethyl-3,3a,4,5,7,7a-hexahydro-2H-1-benzofuran |
| SMILES | CCO[C@@H]1C[C@@H]2[C@@H](C)CC(C)(C)C[C@H]2O1 |
| InChI | InChI=1S/C13H24O2/c1-5-14-12-6-10-9(2)7-13(3,4)8-11(10)15-12/h9-12H,5-8H2,1-4H3/t9-,10+,11+,12-/m0/s1 |
| InChIKey | VREOJYIRUMYBBF-QCNOEVLYSA-N |
| XLogP | 3.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |