C34H24O2 — CID 99943945
(2R,4R,13R,15R)-nonacyclo[14.6.6.65,12.02,15.04,13.06,11.017,22.023,28.029,34]tetratriaconta-6,8,10,17,19,21,23,25,27,29,31,33-dodecaene-3,14-dione (PubChem CID 99943945) has the molecular formula C34H24O2 and a molecular weight of 464.56 g/mol. Its IUPAC name is (2R,4R,13R,15R)-nonacyclo[14.6.6.65,12.02,15.04,13.06,11.017,22.023,28.029,34]tetratriaconta-6,8,10,17,19,21,23,25,27,29,31,33-dodecaene-3,14-dione.
| Compound Name | (2R,4R,13R,15R)-nonacyclo[14.6.6.65,12.02,15.04,13.06,11.017,22.023,28.029,34]tetratriaconta-6,8,10,17,19,21,23,25,27,29,31,33-dodecaene-3,14-dione |
|---|---|
| PubChem CID | 99943945 |
| Molecular Formula | C34H24O2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | (2R,4R,13R,15R)-nonacyclo[14.6.6.65,12.02,15.04,13.06,11.017,22.023,28.029,34]tetratriaconta-6,8,10,17,19,21,23,25,27,29,31,33-dodecaene-3,14-dione |
| SMILES | O=C1[C@@H]2C3c4ccccc4C(c4ccccc43)[C@H]2C(=O)[C@@H]2C3c4ccccc4C(c4ccccc43)[C@@H]12 |
| InChI | InChI=1S/C34H24O2/c35-33-29-25-17-9-1-2-10-18(17)26(20-12-4-3-11-19(20)25)30(29)34(36)32-28-23-15-7-5-13-21(23)27(31(32)33)22-14-6-8-16-24(22)28/h1-16,25-32H/t25?,26?,27?,28?,29-,30-,31-,32-/m1/s1 |
| InChIKey | CGNXAMDXQQTBJJ-GLWVDJIESA-N |
| XLogP | 6.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |