C20H24N4O3 — CID 99944895
4-[2-oxo-2-[4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-1-yl]ethyl]-1,2-dihydropyridazine-3,6-dione (PubChem CID 99944895) has the molecular formula C20H24N4O3 and a molecular weight of 368.44 g/mol. Its IUPAC name is 4-[2-oxo-2-[4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-1-yl]ethyl]-1,2-dihydropyridazine-3,6-dione.
| Compound Name | 4-[2-oxo-2-[4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-1-yl]ethyl]-1,2-dihydropyridazine-3,6-dione |
|---|---|
| PubChem CID | 99944895 |
| Molecular Formula | C20H24N4O3 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 4-[2-oxo-2-[4-[(2S)-1,2,3,4-tetrahydronaphthalen-2-yl]piperazin-1-yl]ethyl]-1,2-dihydropyridazine-3,6-dione |
| SMILES | O=C(Cc1cc(=O)[nH][nH]c1=O)N1CCN([C@H]2CCc3ccccc3C2)CC1 |
| InChI | InChI=1S/C20H24N4O3/c25-18-12-16(20(27)22-21-18)13-19(26)24-9-7-23(8-10-24)17-6-5-14-3-1-2-4-15(14)11-17/h1-4,12,17H,5-11,13H2,(H,21,25)(H,22,27)/t17-/m0/s1 |
| InChIKey | CJLXXBZIQNXWGH-KRWDZBQOSA-N |
| XLogP | 0.31 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |