C9H14N2O — CID 99944912
(3aR,3bS,8aR)-2,3,3a,3b,4,5,6,8a-octahydro-1H-pyrrolo[3,2-a]pyrrolizin-8-one (PubChem CID 99944912) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (3aR,3bS,8aR)-2,3,3a,3b,4,5,6,8a-octahydro-1H-pyrrolo[3,2-a]pyrrolizin-8-one.
| Compound Name | (3aR,3bS,8aR)-2,3,3a,3b,4,5,6,8a-octahydro-1H-pyrrolo[3,2-a]pyrrolizin-8-one |
|---|---|
| PubChem CID | 99944912 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (3aR,3bS,8aR)-2,3,3a,3b,4,5,6,8a-octahydro-1H-pyrrolo[3,2-a]pyrrolizin-8-one |
| SMILES | O=C1[C@@H]2NCC[C@H]2[C@@H]2CCCN12 |
| InChI | InChI=1S/C9H14N2O/c12-9-8-6(3-4-10-8)7-2-1-5-11(7)9/h6-8,10H,1-5H2/t6-,7-,8+/m0/s1 |
| InChIKey | NCJKHZKRPZWDPY-BIIVOSGPSA-N |
| XLogP | -0.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |