C20H23N3O3 — CID 99945004
benzyl (3R)-3-[(1-cyclopropylpyrrole-2-carbonyl)amino]pyrrolidine-1-carboxylate (PubChem CID 99945004) has the molecular formula C20H23N3O3 and a molecular weight of 353.42 g/mol. Its IUPAC name is benzyl (3R)-3-[(1-cyclopropylpyrrole-2-carbonyl)amino]pyrrolidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-[(1-cyclopropylpyrrole-2-carbonyl)amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 99945004 |
| Molecular Formula | C20H23N3O3 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.17 |
| IUPAC Name | benzyl (3R)-3-[(1-cyclopropylpyrrole-2-carbonyl)amino]pyrrolidine-1-carboxylate |
| SMILES | O=C(N[C@@H]1CCN(C(=O)OCc2ccccc2)C1)c1cccn1C1CC1 |
| InChI | InChI=1S/C20H23N3O3/c24-19(18-7-4-11-23(18)17-8-9-17)21-16-10-12-22(13-16)20(25)26-14-15-5-2-1-3-6-15/h1-7,11,16-17H,8-10,12-14H2,(H,21,24)/t16-/m1/s1 |
| InChIKey | ADPJXYZEYRXVPU-MRXNPFEDSA-N |
| XLogP | 2.96 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |