C10H7Cl4NO3 — CID 99947929
(1S,2R,6R,7S)-1,7,8,9-tetrachloro-4-methoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 99947929) has the molecular formula C10H7Cl4NO3 and a molecular weight of 330.98 g/mol. Its IUPAC name is (1S,2R,6R,7S)-1,7,8,9-tetrachloro-4-methoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | (1S,2R,6R,7S)-1,7,8,9-tetrachloro-4-methoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 99947929 |
| Molecular Formula | C10H7Cl4NO3 |
| Molecular Weight | 330.98 g/mol |
| Exact Mass | 328.92 |
| IUPAC Name | (1S,2R,6R,7S)-1,7,8,9-tetrachloro-4-methoxy-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | CON1C(=O)[C@H]2[C@H](C1=O)[C@@]1(Cl)C[C@@]2(Cl)C(Cl)=C1Cl |
| InChI | InChI=1S/C10H7Cl4NO3/c1-18-15-7(16)3-4(8(15)17)10(14)2-9(3,13)5(11)6(10)12/h3-4H,2H2,1H3/t3-,4-,9+,10+/m1/s1 |
| InChIKey | JEOOJQIJGAXGFV-JUVWJLFHSA-N |
| XLogP | 2.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.98 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|