About (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine
(3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine (PubChem CID 99948439) has the molecular formula C13H25N3S
and a molecular weight of 255.43 g/mol. Its IUPAC name is (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine.
Molecular Properties
| Compound Name | (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine |
| PubChem CID | 99948439 |
| Molecular Formula | C13H25N3S |
| Molecular Weight | 255.43 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine |
| SMILES | CS[C@@H](C)CCN(C)CCc1c(C)n[nH]c1C |
| InChI | InChI=1S/C13H25N3S/c1-10(17-5)6-8-16(4)9-7-13-11(2)14-15-12(13)3/h10H,6-9H2,1-5H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | HDADJGMQBMKRAW-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine?
The IUPAC name of (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine (CID 99948439) is (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine.
What is the SMILES notation for (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine?
The canonical SMILES for (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine is CS[C@@H](C)CCN(C)CCc1c(C)n[nH]c1C.
What is the InChIKey of (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine?
The InChIKey is HDADJGMQBMKRAW-JTQLQIEISA-N. The full InChI is InChI=1S/C13H25N3S/c1-10(17-5)6-8-16(4)9-7-13-11(2)14-15-12(13)3/h10H,6-9H2,1-5H3,(H,14,15)/t10-/m0/s1.
What are the key properties of (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine?
(3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine has a molecular weight of 255.43 g/mol, XLogP of 2.64, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-N-[2-(3,5-dimethyl-1H-pyrazol-4-yl)ethyl]-N-methyl-3-methylsulfanylbutan-1-amine is sourced from PubChem (CID 99948439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).